C12H19Cl2N3O2S — CID 103721200
5,6-dichloro-N-[2-[ethyl(propyl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 103721200) has the molecular formula C12H19Cl2N3O2S and a molecular weight of 340.28 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-[ethyl(propyl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-[ethyl(propyl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103721200 |
| Molecular Formula | C12H19Cl2N3O2S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 5,6-dichloro-N-[2-[ethyl(propyl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | CCCN(CC)CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H19Cl2N3O2S/c1-3-6-17(4-2)7-5-16-20(18,19)10-8-11(13)12(14)15-9-10/h8-9,16H,3-7H2,1-2H3 |
| InChIKey | UPNVNJWKLGUFSP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|