C9H12Cl2N2O3S2 — CID 115641392
5,6-dichloro-N-(3-methylsulfinylpropyl)pyridine-3-sulfonamide (PubChem CID 115641392) has the molecular formula C9H12Cl2N2O3S2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-methylsulfinylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3-methylsulfinylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115641392 |
| Molecular Formula | C9H12Cl2N2O3S2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5,6-dichloro-N-(3-methylsulfinylpropyl)pyridine-3-sulfonamide |
| SMILES | CS(=O)CCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O3S2/c1-17(14)4-2-3-13-18(15,16)7-5-8(10)9(11)12-6-7/h5-6,13H,2-4H2,1H3 |
| InChIKey | RMXRCKSTYVUQKJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|