C13H18Cl2N2O2S — CID 79362839
5,6-dichloro-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pyridine-3-sulfonamide (PubChem CID 79362839) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is 5,6-dichloro-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79362839 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5,6-dichloro-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pyridine-3-sulfonamide |
| SMILES | CC1(C)C(CNS(=O)(=O)c2cnc(Cl)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C13H18Cl2N2O2S/c1-12(2)10(13(12,3)4)7-17-20(18,19)8-5-9(14)11(15)16-6-8/h5-6,10,17H,7H2,1-4H3 |
| InChIKey | HZLVQNVSSKFOOZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|