C11H16Cl2N2O3S — CID 65106876
5,6-dichloro-N-(2-ethyl-2-hydroxybutyl)pyridine-3-sulfonamide (PubChem CID 65106876) has the molecular formula C11H16Cl2N2O3S and a molecular weight of 327.23 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-ethyl-2-hydroxybutyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2-ethyl-2-hydroxybutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65106876 |
| Molecular Formula | C11H16Cl2N2O3S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 5,6-dichloro-N-(2-ethyl-2-hydroxybutyl)pyridine-3-sulfonamide |
| SMILES | CCC(O)(CC)CNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2O3S/c1-3-11(16,4-2)7-15-19(17,18)8-5-9(12)10(13)14-6-8/h5-6,15-16H,3-4,7H2,1-2H3 |
| InChIKey | GLQATQMBHWCQDH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|