C12H17Cl2N3O3S — CID 115641375
N-tert-butyl-3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propanamide (PubChem CID 115641375) has the molecular formula C12H17Cl2N3O3S and a molecular weight of 354.26 g/mol. Its IUPAC name is N-tert-butyl-3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propanamide.
| Compound Name | N-tert-butyl-3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 115641375 |
| Molecular Formula | C12H17Cl2N3O3S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-tert-butyl-3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N3O3S/c1-12(2,3)17-10(18)4-5-16-21(19,20)8-6-9(13)11(14)15-7-8/h6-7,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | TVTFCVRGPHKLOA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|