C10H13Cl2N3O3S — CID 110309462
N-[3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propyl]acetamide (PubChem CID 110309462) has the molecular formula C10H13Cl2N3O3S and a molecular weight of 326.21 g/mol. Its IUPAC name is N-[3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propyl]acetamide.
| Compound Name | N-[3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propyl]acetamide |
|---|---|
| PubChem CID | 110309462 |
| Molecular Formula | C10H13Cl2N3O3S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-[3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2N3O3S/c1-7(16)13-3-2-4-15-19(17,18)8-5-9(11)10(12)14-6-8/h5-6,15H,2-4H2,1H3,(H,13,16) |
| InChIKey | CYPDMRCRUXMRGS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|