C8H10Cl2N2O3S2 — CID 115641390
5,6-dichloro-N-(2-methylsulfinylethyl)pyridine-3-sulfonamide (PubChem CID 115641390) has the molecular formula C8H10Cl2N2O3S2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-methylsulfinylethyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2-methylsulfinylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115641390 |
| Molecular Formula | C8H10Cl2N2O3S2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 5,6-dichloro-N-(2-methylsulfinylethyl)pyridine-3-sulfonamide |
| SMILES | CS(=O)CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N2O3S2/c1-16(13)3-2-12-17(14,15)6-4-7(9)8(10)11-5-6/h4-5,12H,2-3H2,1H3 |
| InChIKey | CZHJTIKUGZABCV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|