C12H9Cl3N2O2S — CID 64623963
5,6-dichloro-N-[(4-chlorophenyl)methyl]pyridine-3-sulfonamide (PubChem CID 64623963) has the molecular formula C12H9Cl3N2O2S and a molecular weight of 351.64 g/mol. Its IUPAC name is 5,6-dichloro-N-[(4-chlorophenyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[(4-chlorophenyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64623963 |
| Molecular Formula | C12H9Cl3N2O2S |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 5,6-dichloro-N-[(4-chlorophenyl)methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(Cl)cc1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl3N2O2S/c13-9-3-1-8(2-4-9)6-17-20(18,19)10-5-11(14)12(15)16-7-10/h1-5,7,17H,6H2 |
| InChIKey | SKURWGJISPLDMP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|