C12H10ClF2N3O2S — CID 64602447
6-amino-5-chloro-N-[(3,4-difluorophenyl)methyl]pyridine-3-sulfonamide (PubChem CID 64602447) has the molecular formula C12H10ClF2N3O2S and a molecular weight of 333.75 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[(3,4-difluorophenyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-[(3,4-difluorophenyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64602447 |
| Molecular Formula | C12H10ClF2N3O2S |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 6-amino-5-chloro-N-[(3,4-difluorophenyl)methyl]pyridine-3-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)NCc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C12H10ClF2N3O2S/c13-9-4-8(6-17-12(9)16)21(19,20)18-5-7-1-2-10(14)11(15)3-7/h1-4,6,18H,5H2,(H2,16,17) |
| InChIKey | UGYUMSMNEASBAZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |