C11H8ClF2N3O2S — CID 64600885
6-amino-5-chloro-N-(2,3-difluorophenyl)pyridine-3-sulfonamide (PubChem CID 64600885) has the molecular formula C11H8ClF2N3O2S and a molecular weight of 319.72 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(2,3-difluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(2,3-difluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64600885 |
| Molecular Formula | C11H8ClF2N3O2S |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 6-amino-5-chloro-N-(2,3-difluorophenyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)Nc2cccc(F)c2F)cc1Cl |
| InChI | InChI=1S/C11H8ClF2N3O2S/c12-7-4-6(5-16-11(7)15)20(18,19)17-9-3-1-2-8(13)10(9)14/h1-5,17H,(H2,15,16) |
| InChIKey | LWGFRDIDNRZMBI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |