C9H14ClN3O2S — CID 64607743
6-amino-5-chloro-N-(2-methylpropyl)pyridine-3-sulfonamide (PubChem CID 64607743) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(2-methylpropyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(2-methylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607743 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 6-amino-5-chloro-N-(2-methylpropyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CNS(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-6(2)4-13-16(14,15)7-3-8(10)9(11)12-5-7/h3,5-6,13H,4H2,1-2H3,(H2,11,12) |
| InChIKey | WWTCFVMHGRMAAA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |