C12H19ClN4O2S — CID 105420269
6-amino-5-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]pyridine-3-sulfonamide (PubChem CID 105420269) has the molecular formula C12H19ClN4O2S and a molecular weight of 318.83 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 105420269 |
| Molecular Formula | C12H19ClN4O2S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 6-amino-5-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]pyridine-3-sulfonamide |
| SMILES | CN(C)C1(CNS(=O)(=O)c2cnc(N)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C12H19ClN4O2S/c1-17(2)12(4-3-5-12)8-16-20(18,19)9-6-10(13)11(14)15-7-9/h6-7,16H,3-5,8H2,1-2H3,(H2,14,15) |
| InChIKey | MVHUQOADSXSRJO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |