C10H16ClN3O2S — CID 64601703
6-amino-5-chloro-N-(2-methylbutyl)pyridine-3-sulfonamide (PubChem CID 64601703) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(2-methylbutyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(2-methylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64601703 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-amino-5-chloro-N-(2-methylbutyl)pyridine-3-sulfonamide |
| SMILES | CCC(C)CNS(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C10H16ClN3O2S/c1-3-7(2)5-14-17(15,16)8-4-9(11)10(12)13-6-8/h4,6-7,14H,3,5H2,1-2H3,(H2,12,13) |
| InChIKey | IKYUBWXYHJAOHX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |