C10H14Cl2N2O2S2 — CID 64607088
5,6-dichloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide (PubChem CID 64607088) has the molecular formula C10H14Cl2N2O2S2 and a molecular weight of 329.27 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607088 |
| Molecular Formula | C10H14Cl2N2O2S2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 5,6-dichloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O2S2/c1-7(6-17-2)4-14-18(15,16)8-3-9(11)10(12)13-5-8/h3,5,7,14H,4,6H2,1-2H3 |
| InChIKey | ZDHXBTOCKJVIKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|