C12H19ClN2O2S2 — CID 106064905
3-(aminomethyl)-4-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106064905) has the molecular formula C12H19ClN2O2S2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106064905 |
| Molecular Formula | C12H19ClN2O2S2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1ccc(Cl)c(CN)c1 |
| InChI | InChI=1S/C12H19ClN2O2S2/c1-9(8-18-2)7-15-19(16,17)11-3-4-12(13)10(5-11)6-14/h3-5,9,15H,6-8,14H2,1-2H3 |
| InChIKey | ZUJFDTXXRFVFEG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |