C14H23ClN2O2S2 — CID 106092373
3-(aminomethyl)-4-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 106092373) has the molecular formula C14H23ClN2O2S2 and a molecular weight of 350.94 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106092373 |
| Molecular Formula | C14H23ClN2O2S2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)c1ccc(Cl)c(CN)c1)SC |
| InChI | InChI=1S/C14H23ClN2O2S2/c1-4-14(5-2,20-3)10-17-21(18,19)12-6-7-13(15)11(8-12)9-16/h6-8,17H,4-5,9-10,16H2,1-3H3 |
| InChIKey | IPXSVOKXBDBGJJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |