C13H24N2O2S3 — CID 106092360
5-(aminomethyl)-N-(2-ethyl-2-methylsulfanylbutyl)-2-methylthiophene-3-sulfonamide (PubChem CID 106092360) has the molecular formula C13H24N2O2S3 and a molecular weight of 336.55 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-ethyl-2-methylsulfanylbutyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-ethyl-2-methylsulfanylbutyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106092360 |
| Molecular Formula | C13H24N2O2S3 |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-(aminomethyl)-N-(2-ethyl-2-methylsulfanylbutyl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)c1cc(CN)sc1C)SC |
| InChI | InChI=1S/C13H24N2O2S3/c1-5-13(6-2,18-4)9-15-20(16,17)12-7-11(8-14)19-10(12)3/h7,15H,5-6,8-9,14H2,1-4H3 |
| InChIKey | HUESKNYQPJRJMW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |