C13H17N3O2S2 — CID 106062661
5-(aminomethyl)-2-methyl-N-[(6-methyl-3-pyridinyl)methyl]thiophene-3-sulfonamide (PubChem CID 106062661) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-[(6-methyl-3-pyridinyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-[(6-methyl-3-pyridinyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106062661 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-[(6-methyl-3-pyridinyl)methyl]thiophene-3-sulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2cc(CN)sc2C)cn1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-9-3-4-11(7-15-9)8-16-20(17,18)13-5-12(6-14)19-10(13)2/h3-5,7,16H,6,8,14H2,1-2H3 |
| InChIKey | OTMPANIZUQGTHB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |