C12H22N2O2S3 — CID 106084683
5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 106084683) has the molecular formula C12H22N2O2S3 and a molecular weight of 322.52 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106084683 |
| Molecular Formula | C12H22N2O2S3 |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cc(CN)sc1C |
| InChI | InChI=1S/C12H22N2O2S3/c1-4-17-6-5-9(2)14-19(15,16)12-7-11(8-13)18-10(12)3/h7,9,14H,4-6,8,13H2,1-3H3 |
| InChIKey | XWEPEZLGQRDLSM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|