C13H20F2N2O2S2 — CID 106084642
5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2,3-difluorobenzenesulfonamide (PubChem CID 106084642) has the molecular formula C13H20F2N2O2S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106084642 |
| Molecular Formula | C13H20F2N2O2S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-(aminomethyl)-N-(4-ethylsulfanylbutan-2-yl)-2,3-difluorobenzenesulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cc(CN)cc(F)c1F |
| InChI | InChI=1S/C13H20F2N2O2S2/c1-3-20-5-4-9(2)17-21(18,19)12-7-10(8-16)6-11(14)13(12)15/h6-7,9,17H,3-5,8,16H2,1-2H3 |
| InChIKey | YKOZIDLCZFCGMQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|