C14H23FN2O2S2 — CID 106084558
N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(methylaminomethyl)benzenesulfonamide (PubChem CID 106084558) has the molecular formula C14H23FN2O2S2 and a molecular weight of 334.48 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(methylaminomethyl)benzenesulfonamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106084558 |
| Molecular Formula | C14H23FN2O2S2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(methylaminomethyl)benzenesulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cc(CNC)ccc1F |
| InChI | InChI=1S/C14H23FN2O2S2/c1-4-20-8-7-11(2)17-21(18,19)14-9-12(10-16-3)5-6-13(14)15/h5-6,9,11,16-17H,4,7-8,10H2,1-3H3 |
| InChIKey | PYVJYLVBXARPNK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|