C12H18F2N2O2S — CID 106059156
5-(aminomethyl)-2,3-difluoro-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 106059156) has the molecular formula C12H18F2N2O2S and a molecular weight of 292.35 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-difluoro-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,3-difluoro-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106059156 |
| Molecular Formula | C12H18F2N2O2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(aminomethyl)-2,3-difluoro-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | CC(C)CCNS(=O)(=O)c1cc(CN)cc(F)c1F |
| InChI | InChI=1S/C12H18F2N2O2S/c1-8(2)3-4-16-19(17,18)11-6-9(7-15)5-10(13)12(11)14/h5-6,8,16H,3-4,7,15H2,1-2H3 |
| InChIKey | WJJSTPGQJNWMPK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |