C12H18BrNO2S2 — CID 115662743
4-bromo-N-(4-ethylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 115662743) has the molecular formula C12H18BrNO2S2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 4-bromo-N-(4-ethylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(4-ethylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115662743 |
| Molecular Formula | C12H18BrNO2S2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-bromo-N-(4-ethylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H18BrNO2S2/c1-3-17-9-8-10(2)14-18(15,16)12-6-4-11(13)5-7-12/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | XHNBHMIHSJHTJL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|