C11H18BrNO2S3 — CID 115690382
5-bromo-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 115690382) has the molecular formula C11H18BrNO2S3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 5-bromo-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690382 |
| Molecular Formula | C11H18BrNO2S3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 5-bromo-N-(4-ethylsulfanylbutan-2-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C11H18BrNO2S3/c1-4-16-6-5-8(2)13-18(14,15)10-7-11(12)17-9(10)3/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | OIVRPIQWEVXDQP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|