C13H22BrNO2S2 — CID 102907721
5-bromo-2-methyl-N-(3-methyl-2-propan-2-ylbutyl)thiophene-3-sulfonamide (PubChem CID 102907721) has the molecular formula C13H22BrNO2S2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(3-methyl-2-propan-2-ylbutyl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(3-methyl-2-propan-2-ylbutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102907721 |
| Molecular Formula | C13H22BrNO2S2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 5-bromo-2-methyl-N-(3-methyl-2-propan-2-ylbutyl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCC(C(C)C)C(C)C |
| InChI | InChI=1S/C13H22BrNO2S2/c1-8(2)11(9(3)4)7-15-19(16,17)12-6-13(14)18-10(12)5/h6,8-9,11,15H,7H2,1-5H3 |
| InChIKey | KEZPZBLMUXLILW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |