C9H15BrN2O4S3 — CID 113254406
5-bromo-N-[3-(methanesulfonamido)propyl]-2-methylthiophene-3-sulfonamide (PubChem CID 113254406) has the molecular formula C9H15BrN2O4S3 and a molecular weight of 391.33 g/mol. Its IUPAC name is 5-bromo-N-[3-(methanesulfonamido)propyl]-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-[3-(methanesulfonamido)propyl]-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 113254406 |
| Molecular Formula | C9H15BrN2O4S3 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 5-bromo-N-[3-(methanesulfonamido)propyl]-2-methylthiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C9H15BrN2O4S3/c1-7-8(6-9(10)17-7)19(15,16)12-5-3-4-11-18(2,13)14/h6,11-12H,3-5H2,1-2H3 |
| InChIKey | YXWRBCJHVYQOLC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|