C12H19Br2NO2S2 — CID 106255936
5-bromo-N-[2-(bromomethyl)-2-ethylbutyl]-2-methylthiophene-3-sulfonamide (PubChem CID 106255936) has the molecular formula C12H19Br2NO2S2 and a molecular weight of 433.23 g/mol. Its IUPAC name is 5-bromo-N-[2-(bromomethyl)-2-ethylbutyl]-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-[2-(bromomethyl)-2-ethylbutyl]-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106255936 |
| Molecular Formula | C12H19Br2NO2S2 |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 5-bromo-N-[2-(bromomethyl)-2-ethylbutyl]-2-methylthiophene-3-sulfonamide |
| SMILES | CCC(CC)(CBr)CNS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C12H19Br2NO2S2/c1-4-12(5-2,7-13)8-15-19(16,17)10-6-11(14)18-9(10)3/h6,15H,4-5,7-8H2,1-3H3 |
| InChIKey | STHDKEWIBWUMQF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|