C14H21BrFNO2S — CID 106256050
N-[2-(bromomethyl)-2-ethylbutyl]-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 106256050) has the molecular formula C14H21BrFNO2S and a molecular weight of 366.30 g/mol. Its IUPAC name is N-[2-(bromomethyl)-2-ethylbutyl]-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(bromomethyl)-2-ethylbutyl]-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106256050 |
| Molecular Formula | C14H21BrFNO2S |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[2-(bromomethyl)-2-ethylbutyl]-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | CCC(CC)(CBr)CNS(=O)(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C14H21BrFNO2S/c1-4-14(5-2,9-15)10-17-20(18,19)13-8-12(16)7-6-11(13)3/h6-8,17H,4-5,9-10H2,1-3H3 |
| InChIKey | PINBJSOCDOLWCP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|