C11H9F8NO2S — CID 3682827
5-fluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylbenzenesulfonamide (PubChem CID 3682827) has the molecular formula C11H9F8NO2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 5-fluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-fluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3682827 |
| Molecular Formula | C11H9F8NO2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 5-fluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F8NO2S/c1-6-2-3-7(12)4-8(6)23(21,22)20-5-9(13,14)10(15,16)11(17,18)19/h2-4,20H,5H2,1H3 |
| InChIKey | SAYNFUSGRJKVCN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|