C13H16FNO2S — CID 113255940
5-fluoro-N-hex-5-ynyl-2-methylbenzenesulfonamide (PubChem CID 113255940) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-fluoro-N-hex-5-ynyl-2-methylbenzenesulfonamide.
| Compound Name | 5-fluoro-N-hex-5-ynyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113255940 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-fluoro-N-hex-5-ynyl-2-methylbenzenesulfonamide |
| SMILES | C#CCCCCNS(=O)(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C13H16FNO2S/c1-3-4-5-6-9-15-18(16,17)13-10-12(14)8-7-11(13)2/h1,7-8,10,15H,4-6,9H2,2H3 |
| InChIKey | LBZYWAZCXFKFAA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|