C12H13F2NO2S — CID 113255956
3,4-difluoro-N-hex-5-ynylbenzenesulfonamide (PubChem CID 113255956) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is 3,4-difluoro-N-hex-5-ynylbenzenesulfonamide.
| Compound Name | 3,4-difluoro-N-hex-5-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 113255956 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3,4-difluoro-N-hex-5-ynylbenzenesulfonamide |
| SMILES | C#CCCCCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO2S/c1-2-3-4-5-8-15-18(16,17)10-6-7-11(13)12(14)9-10/h1,6-7,9,15H,3-5,8H2 |
| InChIKey | HVOWXWZLIMBYOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|