C13H17FN2O2S — CID 106208467
3-amino-5-fluoro-N-hex-5-ynyl-4-methylbenzenesulfonamide (PubChem CID 106208467) has the molecular formula C13H17FN2O2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-hex-5-ynyl-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-hex-5-ynyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106208467 |
| Molecular Formula | C13H17FN2O2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-amino-5-fluoro-N-hex-5-ynyl-4-methylbenzenesulfonamide |
| SMILES | C#CCCCCNS(=O)(=O)c1cc(N)c(C)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O2S/c1-3-4-5-6-7-16-19(17,18)11-8-12(14)10(2)13(15)9-11/h1,8-9,16H,4-7,15H2,2H3 |
| InChIKey | XHBJNKBKFHGCDR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|