C10H16FN3O4S2 — CID 106333363
3-amino-5-fluoro-4-methyl-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 106333363) has the molecular formula C10H16FN3O4S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methyl-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methyl-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333363 |
| Molecular Formula | C10H16FN3O4S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-amino-5-fluoro-4-methyl-N-[2-(methylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1cc(N)c(C)c(F)c1 |
| InChI | InChI=1S/C10H16FN3O4S2/c1-7-9(11)5-8(6-10(7)12)20(17,18)14-3-4-19(15,16)13-2/h5-6,13-14H,3-4,12H2,1-2H3 |
| InChIKey | FAKJQJBYDIIDDS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|