C11H17FN2O4S — CID 116791811
3-amino-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-4-methylbenzenesulfonamide (PubChem CID 116791811) has the molecular formula C11H17FN2O4S and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 116791811 |
| Molecular Formula | C11H17FN2O4S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-amino-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCCOCCO)cc1F |
| InChI | InChI=1S/C11H17FN2O4S/c1-8-10(12)6-9(7-11(8)13)19(16,17)14-2-4-18-5-3-15/h6-7,14-15H,2-5,13H2,1H3 |
| InChIKey | VTTPGCXJYUOVDW-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|