C11H14F4N2O3S — CID 116791887
3-amino-5-fluoro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 116791887) has the molecular formula C11H14F4N2O3S and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 116791887 |
| Molecular Formula | C11H14F4N2O3S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-amino-5-fluoro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCCOCC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H14F4N2O3S/c1-7-9(12)4-8(5-10(7)16)21(18,19)17-2-3-20-6-11(13,14)15/h4-5,17H,2-3,6,16H2,1H3 |
| InChIKey | OHPINXQHBYQXDA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|