C11H14ClF3N2O3S — CID 63824801
3-amino-5-chloro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 63824801) has the molecular formula C11H14ClF3N2O3S and a molecular weight of 346.76 g/mol. Its IUPAC name is 3-amino-5-chloro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63824801 |
| Molecular Formula | C11H14ClF3N2O3S |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-amino-5-chloro-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCCOCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H14ClF3N2O3S/c1-7-9(12)4-8(5-10(7)16)21(18,19)17-2-3-20-6-11(13,14)15/h4-5,17H,2-3,6,16H2,1H3 |
| InChIKey | OHMMLASUFCHHLD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|