C14H22ClN3O2S — CID 61107120
3-amino-5-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 61107120) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-amino-5-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61107120 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-amino-5-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O2S/c1-11-13(15)9-12(10-14(11)16)21(19,20)17-5-4-8-18-6-2-3-7-18/h9-10,17H,2-8,16H2,1H3 |
| InChIKey | RGHLGXYGBSOUSZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|