C11H18ClN3O4S2 — CID 106333250
3-amino-5-chloro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide (PubChem CID 106333250) has the molecular formula C11H18ClN3O4S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106333250 |
| Molecular Formula | C11H18ClN3O4S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-amino-5-chloro-N-[3-(methanesulfonamido)propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCCCNS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C11H18ClN3O4S2/c1-8-10(12)6-9(7-11(8)13)21(18,19)15-5-3-4-14-20(2,16)17/h6-7,14-15H,3-5,13H2,1-2H3 |
| InChIKey | PIICZLWBYJHSND-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|