C12H15ClN4O3S — CID 106413778
3-amino-5-chloro-4-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106413778) has the molecular formula C12H15ClN4O3S and a molecular weight of 330.80 g/mol. Its IUPAC name is 3-amino-5-chloro-4-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-4-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106413778 |
| Molecular Formula | C12H15ClN4O3S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-amino-5-chloro-4-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1noc(CCNS(=O)(=O)c2cc(N)c(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H15ClN4O3S/c1-7-10(13)5-9(6-11(7)14)21(18,19)15-4-3-12-16-8(2)17-20-12/h5-6,15H,3-4,14H2,1-2H3 |
| InChIKey | ATZRRUVCDCJKNZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|