C11H16FN3O3S — CID 116791512
N-[2-[(3-amino-5-fluoro-4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 116791512) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-[(3-amino-5-fluoro-4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(3-amino-5-fluoro-4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 116791512 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-[(3-amino-5-fluoro-4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1cc(N)c(C)c(F)c1 |
| InChI | InChI=1S/C11H16FN3O3S/c1-7-10(12)5-9(6-11(7)13)19(17,18)15-4-3-14-8(2)16/h5-6,15H,3-4,13H2,1-2H3,(H,14,16) |
| InChIKey | MEYDMMQFHLSPPO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|