C13H14BrNO4S — CID 106209034
2-bromo-5-(hex-5-ynylsulfamoyl)benzoic acid (PubChem CID 106209034) has the molecular formula C13H14BrNO4S and a molecular weight of 360.23 g/mol. Its IUPAC name is 2-bromo-5-(hex-5-ynylsulfamoyl)benzoic acid.
| Compound Name | 2-bromo-5-(hex-5-ynylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106209034 |
| Molecular Formula | C13H14BrNO4S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 2-bromo-5-(hex-5-ynylsulfamoyl)benzoic acid |
| SMILES | C#CCCCCNS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H14BrNO4S/c1-2-3-4-5-8-15-20(18,19)10-6-7-12(14)11(9-10)13(16)17/h1,6-7,9,15H,3-5,8H2,(H,16,17) |
| InChIKey | ZBLAQPOGRMKIQG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|