C16H17F2NO2S — CID 4509651
3,4-difluoro-N-(4-phenylbutyl)benzenesulfonamide (PubChem CID 4509651) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is 3,4-difluoro-N-(4-phenylbutyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(4-phenylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4509651 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3,4-difluoro-N-(4-phenylbutyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H17F2NO2S/c17-15-10-9-14(12-16(15)18)22(20,21)19-11-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,9-10,12,19H,4-5,8,11H2 |
| InChIKey | CNPDPJYKQHLVES-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|