C12H16F2INO2S — CID 107848959
3,4-difluoro-N-(6-iodohexyl)benzenesulfonamide (PubChem CID 107848959) has the molecular formula C12H16F2INO2S and a molecular weight of 403.23 g/mol. Its IUPAC name is 3,4-difluoro-N-(6-iodohexyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(6-iodohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107848959 |
| Molecular Formula | C12H16F2INO2S |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 3,4-difluoro-N-(6-iodohexyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCCI)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2INO2S/c13-11-6-5-10(9-12(11)14)19(17,18)16-8-4-2-1-3-7-15/h5-6,9,16H,1-4,7-8H2 |
| InChIKey | UMKGJZYJJPPNRR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|