C10H15ClF2N2O2S — CID 119973477
N-[2-(ethylamino)ethyl]-3,4-difluorobenzenesulfonamide;hydrochloride (PubChem CID 119973477) has the molecular formula C10H15ClF2N2O2S and a molecular weight of 300.76 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3,4-difluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3,4-difluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973477 |
| Molecular Formula | C10H15ClF2N2O2S |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3,4-difluorobenzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C10H14F2N2O2S.ClH/c1-2-13-5-6-14-17(15,16)8-3-4-9(11)10(12)7-8;/h3-4,7,13-14H,2,5-6H2,1H3;1H |
| InChIKey | HWYHXKOGLWAJMF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|