C10H13BrFNO2S — CID 43167190
N-(3-bromopropyl)-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 43167190) has the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. Its IUPAC name is N-(3-bromopropyl)-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(3-bromopropyl)-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43167190 |
| Molecular Formula | C10H13BrFNO2S |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | N-(3-bromopropyl)-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCCCBr |
| InChI | InChI=1S/C10H13BrFNO2S/c1-8-3-4-9(12)7-10(8)16(14,15)13-6-2-5-11/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | OOAVXKCPDJYUAK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|