C14H23FN2O2S — CID 106141876
N-(5-amino-2,2-dimethylpentyl)-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 106141876) has the molecular formula C14H23FN2O2S and a molecular weight of 302.41 g/mol. Its IUPAC name is N-(5-amino-2,2-dimethylpentyl)-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(5-amino-2,2-dimethylpentyl)-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106141876 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(5-amino-2,2-dimethylpentyl)-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCC(C)(C)CCCN |
| InChI | InChI=1S/C14H23FN2O2S/c1-11-5-6-12(15)9-13(11)20(18,19)17-10-14(2,3)7-4-8-16/h5-6,9,17H,4,7-8,10,16H2,1-3H3 |
| InChIKey | HKRHBYSAKYSRMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |