C14H24N2O2S — CID 106141735
N-(5-amino-2,2-dimethylpentyl)-3-methylbenzenesulfonamide (PubChem CID 106141735) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N-(5-amino-2,2-dimethylpentyl)-3-methylbenzenesulfonamide.
| Compound Name | N-(5-amino-2,2-dimethylpentyl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106141735 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-(5-amino-2,2-dimethylpentyl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCC(C)(C)CCCN)c1 |
| InChI | InChI=1S/C14H24N2O2S/c1-12-6-4-7-13(10-12)19(17,18)16-11-14(2,3)8-5-9-15/h4,6-7,10,16H,5,8-9,11,15H2,1-3H3 |
| InChIKey | VZXWYBZCCUCKAZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |