C13H22N2O2S — CID 103461066
3-(aminomethyl)-N-(2,2-dimethylbutyl)benzenesulfonamide (PubChem CID 103461066) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,2-dimethylbutyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2,2-dimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103461066 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-(aminomethyl)-N-(2,2-dimethylbutyl)benzenesulfonamide |
| SMILES | CCC(C)(C)CNS(=O)(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C13H22N2O2S/c1-4-13(2,3)10-15-18(16,17)12-7-5-6-11(8-12)9-14/h5-8,15H,4,9-10,14H2,1-3H3 |
| InChIKey | DULGDGRXWHITJA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |