C12H19NO3S — CID 103463059
N-(2,2-dimethylbutyl)-3-hydroxybenzenesulfonamide (PubChem CID 103463059) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-3-hydroxybenzenesulfonamide.
| Compound Name | N-(2,2-dimethylbutyl)-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 103463059 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(2,2-dimethylbutyl)-3-hydroxybenzenesulfonamide |
| SMILES | CCC(C)(C)CNS(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-12(2,3)9-13-17(15,16)11-7-5-6-10(14)8-11/h5-8,13-14H,4,9H2,1-3H3 |
| InChIKey | WARZMKRRHMEWPN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |