C11H15NO3S — CID 81259195
N-(cyclobutylmethyl)-3-hydroxybenzenesulfonamide (PubChem CID 81259195) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-hydroxybenzenesulfonamide.
| Compound Name | N-(cyclobutylmethyl)-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81259195 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-(cyclobutylmethyl)-3-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C11H15NO3S/c13-10-5-2-6-11(7-10)16(14,15)12-8-9-3-1-4-9/h2,5-7,9,12-13H,1,3-4,8H2 |
| InChIKey | SVADBTAUKYYERC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |